C21H25ClN2O2 — CID 145106793
(4R)-bicyclo[2.2.1]hept-2-ene;4-chloro-N-ethyl-1-(oxetan-3-yl)indole-3-carboxamide (PubChem CID 145106793) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is (4R)-bicyclo[2.2.1]hept-2-ene;4-chloro-N-ethyl-1-(oxetan-3-yl)indole-3-carboxamide.
| Compound Name | (4R)-bicyclo[2.2.1]hept-2-ene;4-chloro-N-ethyl-1-(oxetan-3-yl)indole-3-carboxamide |
|---|---|
| PubChem CID | 145106793 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (4R)-bicyclo[2.2.1]hept-2-ene;4-chloro-N-ethyl-1-(oxetan-3-yl)indole-3-carboxamide |
| SMILES | C1=C[C@@H]2CCC1C2.CCNC(=O)c1cn(C2COC2)c2cccc(Cl)c12 |
| InChI | InChI=1S/C14H15ClN2O2.C7H10/c1-2-16-14(18)10-6-17(9-7-19-8-9)12-5-3-4-11(15)13(10)12;1-2-7-4-3-6(1)5-7/h3-6,9H,2,7-8H2,1H3,(H,16,18);1-2,6-7H,3-5H2/t;6-,7?/m.1/s1 |
| InChIKey | OLVFWQYSDXJMIC-KXEXVYKCSA-N |
| XLogP | 4.59 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|