C13H9ClF3NO2 — CID 121393520
1-[4-chloro-1-(oxetan-3-yl)indol-3-yl]-2,2,2-trifluoroethanone (PubChem CID 121393520) has the molecular formula C13H9ClF3NO2 and a molecular weight of 303.67 g/mol. Its IUPAC name is 1-[4-chloro-1-(oxetan-3-yl)indol-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-chloro-1-(oxetan-3-yl)indol-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 121393520 |
| Molecular Formula | C13H9ClF3NO2 |
| Molecular Weight | 303.67 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 1-[4-chloro-1-(oxetan-3-yl)indol-3-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cn(C2COC2)c2cccc(Cl)c12)C(F)(F)F |
| InChI | InChI=1S/C13H9ClF3NO2/c14-9-2-1-3-10-11(9)8(12(19)13(15,16)17)4-18(10)7-5-20-6-7/h1-4,7H,5-6H2 |
| InChIKey | IGIMMOGWMXVIMZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |