C23H33ClN2O2 — CID 145106770
4-chloro-N-(2-cyclopentyl-2-methylpropyl)-1-(oxetan-3-yl)indole-3-carboxamide;ethane (PubChem CID 145106770) has the molecular formula C23H33ClN2O2 and a molecular weight of 404.98 g/mol. Its IUPAC name is 4-chloro-N-(2-cyclopentyl-2-methylpropyl)-1-(oxetan-3-yl)indole-3-carboxamide;ethane.
| Compound Name | 4-chloro-N-(2-cyclopentyl-2-methylpropyl)-1-(oxetan-3-yl)indole-3-carboxamide;ethane |
|---|---|
| PubChem CID | 145106770 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 4-chloro-N-(2-cyclopentyl-2-methylpropyl)-1-(oxetan-3-yl)indole-3-carboxamide;ethane |
| SMILES | CC.CC(C)(CNC(=O)c1cn(C2COC2)c2cccc(Cl)c12)C1CCCC1 |
| InChI | InChI=1S/C21H27ClN2O2.C2H6/c1-21(2,14-6-3-4-7-14)13-23-20(25)16-10-24(15-11-26-12-15)18-9-5-8-17(22)19(16)18;1-2/h5,8-10,14-15H,3-4,6-7,11-13H2,1-2H3,(H,23,25);1-2H3 |
| InChIKey | MCARMFSWXSCZQC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |