C29H29Cl2NO9 — CID 141233892
[(2R,3R,4S,5R)-6-[4-chloro-3-[(4-chlorophenyl)methyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 141233892) has the molecular formula C29H29Cl2NO9 and a molecular weight of 610.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-[4-chloro-3-[(4-chlorophenyl)methyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-6-[4-chloro-3-[(4-chlorophenyl)methyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141233892 |
| Molecular Formula | C29H29Cl2NO9 |
| Molecular Weight | 610.48 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | [(2R,3R,4S,5R)-6-[4-chloro-3-[(4-chlorophenyl)methyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2cc(Cc3ccc(Cl)cc3)c3c(Cl)cccc32)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C29H29Cl2NO9/c1-15(33)37-14-24-26(38-16(2)34)27(39-17(3)35)28(40-18(4)36)29(41-24)32-13-20(12-19-8-10-21(30)11-9-19)25-22(31)6-5-7-23(25)32/h5-11,13,24,26-29H,12,14H2,1-4H3/t24-,26-,27+,28-,29?/m1/s1/i1D,2D,3D,4D |
| InChIKey | CJAIBRGILWXMSD-XKFITMCYSA-N |
| XLogP | 4.79 |
| TPSA | 119.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|