C22H23Cl2NO9 — CID 141233903
[(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-(4,6-dichloroindol-1-yl)oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 141233903) has the molecular formula C22H23Cl2NO9 and a molecular weight of 520.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-(4,6-dichloroindol-1-yl)oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-(4,6-dichloroindol-1-yl)oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141233903 |
| Molecular Formula | C22H23Cl2NO9 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-tris[(2-deuterioacetyl)oxy]-6-(4,6-dichloroindol-1-yl)oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2ccc3c(Cl)cc(Cl)cc32)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C22H23Cl2NO9/c1-10(26)30-9-18-19(31-11(2)27)20(32-12(3)28)21(33-13(4)29)22(34-18)25-6-5-15-16(24)7-14(23)8-17(15)25/h5-8,18-22H,9H2,1-4H3/t18-,19-,20+,21-,22?/m1/s1/i1D,2D,3D,4D |
| InChIKey | FULCHXIBLCGRIX-FDHIHWLSSA-N |
| XLogP | 3.20 |
| TPSA | 119.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|