C30H30ClF2NO11 — CID 141233930
[(2R,3R,4S,5R)-6-[4-chloro-3-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate (PubChem CID 141233930) has the molecular formula C30H30ClF2NO11 and a molecular weight of 658.04 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-[4-chloro-3-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-6-[4-chloro-3-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141233930 |
| Molecular Formula | C30H30ClF2NO11 |
| Molecular Weight | 658.04 g/mol |
| Exact Mass | 657.17 |
| IUPAC Name | [(2R,3R,4S,5R)-6-[4-chloro-3-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]indol-1-yl]-3,4,5-tris[(2-deuterioacetyl)oxy]oxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(n2cc(C(O)c3ccc(OC(F)F)cc3)c3c(Cl)cccc32)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C30H30ClF2NO11/c1-14(35)40-13-23-26(41-15(2)36)27(42-16(3)37)28(43-17(4)38)29(45-23)34-12-20(24-21(31)6-5-7-22(24)34)25(39)18-8-10-19(11-9-18)44-30(32)33/h5-12,23,25-30,39H,13H2,1-4H3/t23-,25?,26-,27+,28-,29?/m1/s1/i1D,2D,3D,4D |
| InChIKey | IUXUOPWPGHQNLA-YEEUJZLRSA-N |
| XLogP | 4.23 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.04 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|