C30H29ClF3NO10 — CID 67199097
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]indol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 67199097) has the molecular formula C30H29ClF3NO10 and a molecular weight of 656.01 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]indol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]indol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67199097 |
| Molecular Formula | C30H29ClF3NO10 |
| Molecular Weight | 656.01 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(trifluoromethoxy)phenyl]methyl]indol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(Cc3ccc(OC(F)(F)F)cc3)c3c(Cl)cccc32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H29ClF3NO10/c1-15(36)40-14-24-26(41-16(2)37)27(42-17(3)38)28(43-18(4)39)29(44-24)35-13-20(25-22(31)6-5-7-23(25)35)12-19-8-10-21(11-9-19)45-30(32,33)34/h5-11,13,24,26-29H,12,14H2,1-4H3/t24-,26-,27+,28-,29-/m1/s1 |
| InChIKey | KJHXLCUZYPWZMV-KRZJEZTLSA-N |
| XLogP | 5.04 |
| TPSA | 128.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.01 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|