C24H24ClNO7S — CID 50992739
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-[4-chloro-3-(thiophen-2-ylmethyl)indol-1-yl]oxan-3-yl] acetate (PubChem CID 50992739) has the molecular formula C24H24ClNO7S and a molecular weight of 505.98 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[4-chloro-3-(thiophen-2-ylmethyl)indol-1-yl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[4-chloro-3-(thiophen-2-ylmethyl)indol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 50992739 |
| Molecular Formula | C24H24ClNO7S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[4-chloro-3-(thiophen-2-ylmethyl)indol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1cc(Cc2cccs2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C24H24ClNO7S/c1-13(27)31-20-12-30-24(23(33-15(3)29)22(20)32-14(2)28)26-11-16(10-17-6-5-9-34-17)21-18(25)7-4-8-19(21)26/h4-9,11,20,22-24H,10,12H2,1-3H3/t20-,22+,23-,24-/m1/s1 |
| InChIKey | TZNYNJWWAWZAJU-GNLZIIPMSA-N |
| XLogP | 4.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|