C27H26ClNO10 — CID 50992594
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[1,3-benzodioxol-5-yl(hydroxy)methyl]-4-chloroindol-1-yl]oxan-3-yl] acetate (PubChem CID 50992594) has the molecular formula C27H26ClNO10 and a molecular weight of 559.96 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[1,3-benzodioxol-5-yl(hydroxy)methyl]-4-chloroindol-1-yl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[1,3-benzodioxol-5-yl(hydroxy)methyl]-4-chloroindol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 50992594 |
| Molecular Formula | C27H26ClNO10 |
| Molecular Weight | 559.96 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[3-[1,3-benzodioxol-5-yl(hydroxy)methyl]-4-chloroindol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CO[C@H]1n1cc(C(O)c2ccc3c(c2)OCO3)c2c(Cl)cccc21 |
| InChI | InChI=1S/C27H26ClNO10/c1-13(30)37-22-11-34-27(26(39-15(3)32)25(22)38-14(2)31)29-10-17(23-18(28)5-4-6-19(23)29)24(33)16-7-8-20-21(9-16)36-12-35-20/h4-10,22,24-27,33H,11-12H2,1-3H3/t22-,24?,25+,26-,27-/m1/s1 |
| InChIKey | HBKAHLVMWJGZBN-RJXUSAAPSA-N |
| XLogP | 3.43 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.96 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|