C23H23ClN4O5S — CID 169004432
[(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-hex-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate (PubChem CID 169004432) has the molecular formula C23H23ClN4O5S and a molecular weight of 502.98 g/mol. Its IUPAC name is [(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-hex-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate.
| Compound Name | [(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-hex-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 169004432 |
| Molecular Formula | C23H23ClN4O5S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | [(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-hex-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate |
| SMILES | CCCCC#Cc1nc(Cl)c2nc(-c3cccs3)n([C@@H]3OC[C@@H](OC(C)=O)[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C23H23ClN4O5S/c1-4-5-6-7-10-17-25-20(24)18-22(26-17)28(21(27-18)16-9-8-11-34-16)23-19(33-14(3)30)15(12-31-23)32-13(2)29/h8-9,11,15,19,23H,4-6,12H2,1-3H3/t15-,19-,23-/m1/s1 |
| InChIKey | PCERPLUNDVTKRF-NFHUAXAMSA-N |
| XLogP | 4.14 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|