C20H22ClN5O2S — CID 175489363
[6-chloro-2-hex-1-ynyl-8-(1,3-thiazol-5-yl)purin-9-yl] 2,2-dimethylbutanoate (PubChem CID 175489363) has the molecular formula C20H22ClN5O2S and a molecular weight of 431.95 g/mol. Its IUPAC name is [6-chloro-2-hex-1-ynyl-8-(1,3-thiazol-5-yl)purin-9-yl] 2,2-dimethylbutanoate.
| Compound Name | [6-chloro-2-hex-1-ynyl-8-(1,3-thiazol-5-yl)purin-9-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 175489363 |
| Molecular Formula | C20H22ClN5O2S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [6-chloro-2-hex-1-ynyl-8-(1,3-thiazol-5-yl)purin-9-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCC#Cc1nc(Cl)c2nc(-c3cncs3)n(OC(=O)C(C)(C)CC)c2n1 |
| InChI | InChI=1S/C20H22ClN5O2S/c1-5-7-8-9-10-14-23-16(21)15-18(24-14)26(28-19(27)20(3,4)6-2)17(25-15)13-11-22-12-29-13/h11-12H,5-8H2,1-4H3 |
| InChIKey | UGMKQACOLQKUNU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|