C27H31ClN4O5S — CID 169004573
[(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-dec-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate (PubChem CID 169004573) has the molecular formula C27H31ClN4O5S and a molecular weight of 559.09 g/mol. Its IUPAC name is [(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-dec-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate.
| Compound Name | [(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-dec-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 169004573 |
| Molecular Formula | C27H31ClN4O5S |
| Molecular Weight | 559.09 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [(3R,4R,5R)-4-acetyloxy-5-(6-chloro-2-dec-1-ynyl-8-thiophen-2-ylpurin-9-yl)oxolan-3-yl] acetate |
| SMILES | CCCCCCCCC#Cc1nc(Cl)c2nc(-c3cccs3)n([C@@H]3OC[C@@H](OC(C)=O)[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C27H31ClN4O5S/c1-4-5-6-7-8-9-10-11-14-21-29-24(28)22-26(30-21)32(25(31-22)20-13-12-15-38-20)27-23(37-18(3)34)19(16-35-27)36-17(2)33/h12-13,15,19,23,27H,4-10,16H2,1-3H3/t19-,23-,27-/m1/s1 |
| InChIKey | IYDJAHUAACJDAZ-AUZMWRNASA-N |
| XLogP | 5.70 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.09 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|