C19H23N5OS — CID 169004389
9-(2-ethoxyethyl)-2-hex-1-ynyl-8-thiophen-2-ylpurin-6-amine (PubChem CID 169004389) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is 9-(2-ethoxyethyl)-2-hex-1-ynyl-8-thiophen-2-ylpurin-6-amine.
| Compound Name | 9-(2-ethoxyethyl)-2-hex-1-ynyl-8-thiophen-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 169004389 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 9-(2-ethoxyethyl)-2-hex-1-ynyl-8-thiophen-2-ylpurin-6-amine |
| SMILES | CCCCC#Cc1nc(N)c2nc(-c3cccs3)n(CCOCC)c2n1 |
| InChI | InChI=1S/C19H23N5OS/c1-3-5-6-7-10-15-21-17(20)16-19(22-15)24(11-12-25-4-2)18(23-16)14-9-8-13-26-14/h8-9,13H,3-6,11-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | IOZQMLYANWSOKA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|