C17H14FN5O2 — CID 22133893
5-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]pent-4-ynoic acid (PubChem CID 22133893) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is 5-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]pent-4-ynoic acid.
| Compound Name | 5-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 22133893 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]pent-4-ynoic acid |
| SMILES | Cn1c(-c2cccc(F)c2)nc2c(N)nc(C#CCCC(=O)O)nc21 |
| InChI | InChI=1S/C17H14FN5O2/c1-23-16(10-5-4-6-11(18)9-10)22-14-15(19)20-12(21-17(14)23)7-2-3-8-13(24)25/h4-6,9H,3,8H2,1H3,(H,24,25)(H2,19,20,21) |
| InChIKey | XUNPFRHCHPVURC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|