C24H29FN6O3S — CID 23579513
3-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]-N-ethylpropane-1-sulfonamide (PubChem CID 23579513) has the molecular formula C24H29FN6O3S and a molecular weight of 500.60 g/mol. Its IUPAC name is 3-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]-N-ethylpropane-1-sulfonamide.
| Compound Name | 3-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]-N-ethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 23579513 |
| Molecular Formula | C24H29FN6O3S |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 3-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]-N-ethylpropane-1-sulfonamide |
| SMILES | CCNS(=O)(=O)CCCn1c(-c2cccc(F)c2)nc2c(N)nc(C#CC3(O)CCCCC3)nc21 |
| InChI | InChI=1S/C24H29FN6O3S/c1-2-27-35(33,34)15-7-14-31-22(17-8-6-9-18(25)16-17)30-20-21(26)28-19(29-23(20)31)10-13-24(32)11-4-3-5-12-24/h6,8-9,16,27,32H,2-5,7,11-12,14-15H2,1H3,(H2,26,28,29) |
| InChIKey | KITCRATZXSIIHV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|