C20H19F2N5O — CID 20593856
1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclopentan-1-ol (PubChem CID 20593856) has the molecular formula C20H19F2N5O and a molecular weight of 383.40 g/mol. Its IUPAC name is 1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 20593856 |
| Molecular Formula | C20H19F2N5O |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclopentan-1-ol |
| SMILES | CCn1c(-c2cc(F)cc(F)c2)nc2c(N)nc(C#CC3(O)CCCC3)nc21 |
| InChI | InChI=1S/C20H19F2N5O/c1-2-27-18(12-9-13(21)11-14(22)10-12)26-16-17(23)24-15(25-19(16)27)5-8-20(28)6-3-4-7-20/h9-11,28H,2-4,6-7H2,1H3,(H2,23,24,25) |
| InChIKey | JOKYMBVRVVDJIV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|