C19H18FN5O — CID 20593866
1-[2-[6-amino-8-(3-fluorophenyl)-7H-purin-2-yl]ethynyl]cyclohexan-1-ol (PubChem CID 20593866) has the molecular formula C19H18FN5O and a molecular weight of 351.39 g/mol. Its IUPAC name is 1-[2-[6-amino-8-(3-fluorophenyl)-7H-purin-2-yl]ethynyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[6-amino-8-(3-fluorophenyl)-7H-purin-2-yl]ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 20593866 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-[2-[6-amino-8-(3-fluorophenyl)-7H-purin-2-yl]ethynyl]cyclohexan-1-ol |
| SMILES | Nc1nc(C#CC2(O)CCCCC2)nc2nc(-c3cccc(F)c3)[nH]c12 |
| InChI | InChI=1S/C19H18FN5O/c20-13-6-4-5-12(11-13)17-24-15-16(21)22-14(23-18(15)25-17)7-10-19(26)8-2-1-3-9-19/h4-6,11,26H,1-3,8-9H2,(H3,21,22,23,24,25) |
| InChIKey | RJWGEVSXTOUJDI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|