C21H20FN5O3 — CID 22133910
2-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]acetic acid (PubChem CID 22133910) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]acetic acid.
| Compound Name | 2-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 22133910 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[6-amino-8-(3-fluorophenyl)-2-[2-(1-hydroxycyclohexyl)ethynyl]purin-9-yl]acetic acid |
| SMILES | Nc1nc(C#CC2(O)CCCCC2)nc2c1nc(-c1cccc(F)c1)n2CC(=O)O |
| InChI | InChI=1S/C21H20FN5O3/c22-14-6-4-5-13(11-14)19-26-17-18(23)24-15(25-20(17)27(19)12-16(28)29)7-10-21(30)8-2-1-3-9-21/h4-6,11,30H,1-3,8-9,12H2,(H,28,29)(H2,23,24,25) |
| InChIKey | OGGMAEQMBURNFA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|