C26H25ClFN5O2 — CID 22133905
1-[2-[6-amino-8-(3-fluorophenyl)-9-(3-methoxyphenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride (PubChem CID 22133905) has the molecular formula C26H25ClFN5O2 and a molecular weight of 493.97 g/mol. Its IUPAC name is 1-[2-[6-amino-8-(3-fluorophenyl)-9-(3-methoxyphenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[2-[6-amino-8-(3-fluorophenyl)-9-(3-methoxyphenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 22133905 |
| Molecular Formula | C26H25ClFN5O2 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 1-[2-[6-amino-8-(3-fluorophenyl)-9-(3-methoxyphenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride |
| SMILES | COc1cccc(-n2c(-c3cccc(F)c3)nc3c(N)nc(C#CC4(O)CCCCC4)nc32)c1.Cl |
| InChI | InChI=1S/C26H24FN5O2.ClH/c1-34-20-10-6-9-19(16-20)32-24(17-7-5-8-18(27)15-17)31-22-23(28)29-21(30-25(22)32)11-14-26(33)12-3-2-4-13-26;/h5-10,15-16,33H,2-4,12-13H2,1H3,(H2,28,29,30);1H |
| InChIKey | VAVQARKDWQFVSM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|