C15H12FN5O — CID 20593939
3-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]prop-2-yn-1-ol (PubChem CID 20593939) has the molecular formula C15H12FN5O and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]prop-2-yn-1-ol.
| Compound Name | 3-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 20593939 |
| Molecular Formula | C15H12FN5O |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]prop-2-yn-1-ol |
| SMILES | Cn1c(-c2cccc(F)c2)nc2c(N)nc(C#CCO)nc21 |
| InChI | InChI=1S/C15H12FN5O/c1-21-14(9-4-2-5-10(16)8-9)20-12-13(17)18-11(6-3-7-22)19-15(12)21/h2,4-5,8,22H,7H2,1H3,(H2,17,18,19) |
| InChIKey | CAAVWMHJOZZFCT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|