C19H20FN5O — CID 20593910
1-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]-3,4-dimethylpent-1-yn-3-ol (PubChem CID 20593910) has the molecular formula C19H20FN5O and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]-3,4-dimethylpent-1-yn-3-ol.
| Compound Name | 1-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]-3,4-dimethylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 20593910 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[6-amino-8-(3-fluorophenyl)-9-methylpurin-2-yl]-3,4-dimethylpent-1-yn-3-ol |
| SMILES | CC(C)C(C)(O)C#Cc1nc(N)c2nc(-c3cccc(F)c3)n(C)c2n1 |
| InChI | InChI=1S/C19H20FN5O/c1-11(2)19(3,26)9-8-14-22-16(21)15-18(23-14)25(4)17(24-15)12-6-5-7-13(20)10-12/h5-7,10-11,26H,1-4H3,(H2,21,22,23) |
| InChIKey | HORZREMXDQKULK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|