C16H14FN5O3 — CID 20593965
8-(3-fluorophenyl)-9-methyl-2-[4-(trioxidanyl)but-1-ynyl]purin-6-amine (PubChem CID 20593965) has the molecular formula C16H14FN5O3 and a molecular weight of 343.32 g/mol. Its IUPAC name is 8-(3-fluorophenyl)-9-methyl-2-[4-(trioxidanyl)but-1-ynyl]purin-6-amine.
| Compound Name | 8-(3-fluorophenyl)-9-methyl-2-[4-(trioxidanyl)but-1-ynyl]purin-6-amine |
|---|---|
| PubChem CID | 20593965 |
| Molecular Formula | C16H14FN5O3 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 8-(3-fluorophenyl)-9-methyl-2-[4-(trioxidanyl)but-1-ynyl]purin-6-amine |
| SMILES | Cn1c(-c2cccc(F)c2)nc2c(N)nc(C#CCCOOO)nc21 |
| InChI | InChI=1S/C16H14FN5O3/c1-22-15(10-5-4-6-11(17)9-10)21-13-14(18)19-12(20-16(13)22)7-2-3-8-24-25-23/h4-6,9,23H,3,8H2,1H3,(H2,18,19,20) |
| InChIKey | XHXJUDKULMTAGI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|