C28H22FN5 — CID 22133797
2-(3,3-diphenylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine (PubChem CID 22133797) has the molecular formula C28H22FN5 and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-(3,3-diphenylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine.
| Compound Name | 2-(3,3-diphenylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine |
|---|---|
| PubChem CID | 22133797 |
| Molecular Formula | C28H22FN5 |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-(3,3-diphenylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine |
| SMILES | Cn1c(-c2cccc(F)c2)nc2c(N)nc(C#CC(C)(c3ccccc3)c3ccccc3)nc21 |
| InChI | InChI=1S/C28H22FN5/c1-28(20-11-5-3-6-12-20,21-13-7-4-8-14-21)17-16-23-31-25(30)24-27(32-23)34(2)26(33-24)19-10-9-15-22(29)18-19/h3-15,18H,1-2H3,(H2,30,31,32) |
| InChIKey | JTCFGUKBHNEJCW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|