C18H18FN5 — CID 20593924
2-(3,3-dimethylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine (PubChem CID 20593924) has the molecular formula C18H18FN5 and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-(3,3-dimethylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine.
| Compound Name | 2-(3,3-dimethylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine |
|---|---|
| PubChem CID | 20593924 |
| Molecular Formula | C18H18FN5 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(3,3-dimethylbut-1-ynyl)-8-(3-fluorophenyl)-9-methylpurin-6-amine |
| SMILES | Cn1c(-c2cccc(F)c2)nc2c(N)nc(C#CC(C)(C)C)nc21 |
| InChI | InChI=1S/C18H18FN5/c1-18(2,3)9-8-13-21-15(20)14-17(22-13)24(4)16(23-14)11-6-5-7-12(19)10-11/h5-7,10H,1-4H3,(H2,20,21,22) |
| InChIKey | LNDQKQKDIFZRMO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|