C22H24FN5O — CID 20593876
1-[2-[6-amino-8-(3-fluorophenyl)-9-propylpurin-2-yl]ethynyl]cyclohexan-1-ol (PubChem CID 20593876) has the molecular formula C22H24FN5O and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[2-[6-amino-8-(3-fluorophenyl)-9-propylpurin-2-yl]ethynyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[6-amino-8-(3-fluorophenyl)-9-propylpurin-2-yl]ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 20593876 |
| Molecular Formula | C22H24FN5O |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-[2-[6-amino-8-(3-fluorophenyl)-9-propylpurin-2-yl]ethynyl]cyclohexan-1-ol |
| SMILES | CCCn1c(-c2cccc(F)c2)nc2c(N)nc(C#CC3(O)CCCCC3)nc21 |
| InChI | InChI=1S/C22H24FN5O/c1-2-13-28-20(15-7-6-8-16(23)14-15)27-18-19(24)25-17(26-21(18)28)9-12-22(29)10-4-3-5-11-22/h6-8,14,29H,2-5,10-11,13H2,1H3,(H2,24,25,26) |
| InChIKey | SBHIBNQAZCXCNV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|