C19H17F2N5O — CID 20593855
1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclobutan-1-ol (PubChem CID 20593855) has the molecular formula C19H17F2N5O and a molecular weight of 369.38 g/mol. Its IUPAC name is 1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclobutan-1-ol.
| Compound Name | 1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 20593855 |
| Molecular Formula | C19H17F2N5O |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[2-[6-amino-8-(3,5-difluorophenyl)-9-ethylpurin-2-yl]ethynyl]cyclobutan-1-ol |
| SMILES | CCn1c(-c2cc(F)cc(F)c2)nc2c(N)nc(C#CC3(O)CCC3)nc21 |
| InChI | InChI=1S/C19H17F2N5O/c1-2-26-17(11-8-12(20)10-13(21)9-11)25-15-16(22)23-14(24-18(15)26)4-7-19(27)5-3-6-19/h8-10,27H,2-3,5-6H2,1H3,(H2,22,23,24) |
| InChIKey | OEBUXVXALKOTLH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|