C23H27ClFN5O — CID 18515706
1-[2-[6-amino-8-(3-fluorophenyl)-9-(2-methylpropyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride (PubChem CID 18515706) has the molecular formula C23H27ClFN5O and a molecular weight of 443.95 g/mol. Its IUPAC name is 1-[2-[6-amino-8-(3-fluorophenyl)-9-(2-methylpropyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[2-[6-amino-8-(3-fluorophenyl)-9-(2-methylpropyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 18515706 |
| Molecular Formula | C23H27ClFN5O |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 1-[2-[6-amino-8-(3-fluorophenyl)-9-(2-methylpropyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride |
| SMILES | CC(C)Cn1c(-c2cccc(F)c2)nc2c(N)nc(C#CC3(O)CCCCC3)nc21.Cl |
| InChI | InChI=1S/C23H26FN5O.ClH/c1-15(2)14-29-21(16-7-6-8-17(24)13-16)28-19-20(25)26-18(27-22(19)29)9-12-23(30)10-4-3-5-11-23;/h6-8,13,15,30H,3-5,10-11,14H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | XMTPNFAPVLBYOZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|