C23H23ClFN5O — CID 22133945
1-[2-[6-amino-9-but-2-ynyl-8-(3-fluorophenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride (PubChem CID 22133945) has the molecular formula C23H23ClFN5O and a molecular weight of 439.92 g/mol. Its IUPAC name is 1-[2-[6-amino-9-but-2-ynyl-8-(3-fluorophenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[2-[6-amino-9-but-2-ynyl-8-(3-fluorophenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 22133945 |
| Molecular Formula | C23H23ClFN5O |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[2-[6-amino-9-but-2-ynyl-8-(3-fluorophenyl)purin-2-yl]ethynyl]cyclohexan-1-ol;hydrochloride |
| SMILES | CC#CCn1c(-c2cccc(F)c2)nc2c(N)nc(C#CC3(O)CCCCC3)nc21.Cl |
| InChI | InChI=1S/C23H22FN5O.ClH/c1-2-3-14-29-21(16-8-7-9-17(24)15-16)28-19-20(25)26-18(27-22(19)29)10-13-23(30)11-5-4-6-12-23;/h7-9,15,30H,4-6,11-12,14H2,1H3,(H2,25,26,27);1H |
| InChIKey | IVZUFHPRLUXBLS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|