C20H14FN5 — CID 91556629
8-(3-fluorophenyl)-9-methyl-2-(2-phenylethynyl)purin-6-amine (PubChem CID 91556629) has the molecular formula C20H14FN5 and a molecular weight of 343.37 g/mol. Its IUPAC name is 8-(3-fluorophenyl)-9-methyl-2-(2-phenylethynyl)purin-6-amine.
| Compound Name | 8-(3-fluorophenyl)-9-methyl-2-(2-phenylethynyl)purin-6-amine |
|---|---|
| PubChem CID | 91556629 |
| Molecular Formula | C20H14FN5 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 8-(3-fluorophenyl)-9-methyl-2-(2-phenylethynyl)purin-6-amine |
| SMILES | Cn1c(-c2cccc(F)c2)nc2c(N)nc(C#Cc3ccccc3)nc21 |
| InChI | InChI=1S/C20H14FN5/c1-26-19(14-8-5-9-15(21)12-14)25-17-18(22)23-16(24-20(17)26)11-10-13-6-3-2-4-7-13/h2-9,12H,1H3,(H2,22,23,24) |
| InChIKey | ZXBXWSIQLPJZBB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|