C19H21N7O2S — CID 169004616
(2R,3R,4S)-2-(6-amino-2-hex-1-ynyl-8-pyrimidin-2-ylpurin-9-yl)thiolane-3,4-diol (PubChem CID 169004616) has the molecular formula C19H21N7O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is (2R,3R,4S)-2-(6-amino-2-hex-1-ynyl-8-pyrimidin-2-ylpurin-9-yl)thiolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(6-amino-2-hex-1-ynyl-8-pyrimidin-2-ylpurin-9-yl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 169004616 |
| Molecular Formula | C19H21N7O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (2R,3R,4S)-2-(6-amino-2-hex-1-ynyl-8-pyrimidin-2-ylpurin-9-yl)thiolane-3,4-diol |
| SMILES | CCCCC#Cc1nc(N)c2nc(-c3ncccn3)n([C@@H]3SC[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C19H21N7O2S/c1-2-3-4-5-7-12-23-15(20)13-17(24-12)26(19-14(28)11(27)10-29-19)18(25-13)16-21-8-6-9-22-16/h6,8-9,11,14,19,27-28H,2-4,10H2,1H3,(H2,20,23,24)/t11-,14-,19-/m1/s1 |
| InChIKey | TYRXKBJLBJADJJ-FRGNPEFRSA-N |
| XLogP | 1.37 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|