C18H21N5O3 — CID 169004419
3-[6-amino-8-(furan-2-yl)-2-hex-1-ynylpurin-9-yl]propane-1,2-diol (PubChem CID 169004419) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-[6-amino-8-(furan-2-yl)-2-hex-1-ynylpurin-9-yl]propane-1,2-diol.
| Compound Name | 3-[6-amino-8-(furan-2-yl)-2-hex-1-ynylpurin-9-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 169004419 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-[6-amino-8-(furan-2-yl)-2-hex-1-ynylpurin-9-yl]propane-1,2-diol |
| SMILES | CCCCC#Cc1nc(N)c2nc(-c3ccco3)n(CC(O)CO)c2n1 |
| InChI | InChI=1S/C18H21N5O3/c1-2-3-4-5-8-14-20-16(19)15-18(21-14)23(10-12(25)11-24)17(22-15)13-7-6-9-26-13/h6-7,9,12,24-25H,2-4,10-11H2,1H3,(H2,19,20,21) |
| InChIKey | XOEBYKGDFQJQPE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|