C19H23N5O — CID 169004627
2-dec-1-ynyl-8-(furan-2-yl)-7H-purin-6-amine (PubChem CID 169004627) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-dec-1-ynyl-8-(furan-2-yl)-7H-purin-6-amine.
| Compound Name | 2-dec-1-ynyl-8-(furan-2-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 169004627 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-dec-1-ynyl-8-(furan-2-yl)-7H-purin-6-amine |
| SMILES | CCCCCCCCC#Cc1nc(N)c2[nH]c(-c3ccco3)nc2n1 |
| InChI | InChI=1S/C19H23N5O/c1-2-3-4-5-6-7-8-9-12-15-21-17(20)16-19(22-15)24-18(23-16)14-11-10-13-25-14/h10-11,13H,2-8H2,1H3,(H3,20,21,22,23,24) |
| InChIKey | XHROHEXAUNYJMZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|