C24H27ClN4O4 — CID 169004571
[(2R,3R)-2-[6-chloro-8-(furan-2-yl)-2-non-1-ynylpurin-9-yl]oxolan-3-yl] acetate (PubChem CID 169004571) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is [(2R,3R)-2-[6-chloro-8-(furan-2-yl)-2-non-1-ynylpurin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R)-2-[6-chloro-8-(furan-2-yl)-2-non-1-ynylpurin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 169004571 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [(2R,3R)-2-[6-chloro-8-(furan-2-yl)-2-non-1-ynylpurin-9-yl]oxolan-3-yl] acetate |
| SMILES | CCCCCCCC#Cc1nc(Cl)c2nc(-c3ccco3)n([C@@H]3OCC[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C24H27ClN4O4/c1-3-4-5-6-7-8-9-12-19-26-21(25)20-23(27-19)29(22(28-20)17-11-10-14-31-17)24-18(13-15-32-24)33-16(2)30/h10-11,14,18,24H,3-8,13,15H2,1-2H3/t18-,24-/m1/s1 |
| InChIKey | ORRFCEVCKIUZTP-HOYKHHGWSA-N |
| XLogP | 5.30 |
| TPSA | 92.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|