C20H19ClN4O4 — CID 171058711
2-[(2R,3R)-2-[2-but-1-ynyl-6-chloro-8-(5-methylfuran-2-yl)purin-9-yl]oxolan-3-yl]acetic acid (PubChem CID 171058711) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is 2-[(2R,3R)-2-[2-but-1-ynyl-6-chloro-8-(5-methylfuran-2-yl)purin-9-yl]oxolan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R)-2-[2-but-1-ynyl-6-chloro-8-(5-methylfuran-2-yl)purin-9-yl]oxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 171058711 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[(2R,3R)-2-[2-but-1-ynyl-6-chloro-8-(5-methylfuran-2-yl)purin-9-yl]oxolan-3-yl]acetic acid |
| SMILES | CCC#Cc1nc(Cl)c2nc(-c3ccc(C)o3)n([C@@H]3OCC[C@@H]3CC(=O)O)c2n1 |
| InChI | InChI=1S/C20H19ClN4O4/c1-3-4-5-14-22-17(21)16-19(23-14)25(18(24-16)13-7-6-11(2)29-13)20-12(8-9-28-20)10-15(26)27/h6-7,12,20H,3,8-10H2,1-2H3,(H,26,27)/t12-,20-/m1/s1 |
| InChIKey | FBRXFZLQYZXYOT-MPBGBICISA-N |
| XLogP | 3.82 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|