C23H24ClN5O4 — CID 174205698
[2-[6-chloro-2-hex-1-ynyl-8-(6-methoxy-2-pyridinyl)purin-9-yl]oxolan-3-yl] acetate (PubChem CID 174205698) has the molecular formula C23H24ClN5O4 and a molecular weight of 469.93 g/mol. Its IUPAC name is [2-[6-chloro-2-hex-1-ynyl-8-(6-methoxy-2-pyridinyl)purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [2-[6-chloro-2-hex-1-ynyl-8-(6-methoxy-2-pyridinyl)purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 174205698 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | [2-[6-chloro-2-hex-1-ynyl-8-(6-methoxy-2-pyridinyl)purin-9-yl]oxolan-3-yl] acetate |
| SMILES | CCCCC#Cc1nc(Cl)c2nc(-c3cccc(OC)n3)n(C3OCCC3OC(C)=O)c2n1 |
| InChI | InChI=1S/C23H24ClN5O4/c1-4-5-6-7-10-17-26-20(24)19-22(27-17)29(23-16(12-13-32-23)33-14(2)30)21(28-19)15-9-8-11-18(25-15)31-3/h8-9,11,16,23H,4-6,12-13H2,1-3H3 |
| InChIKey | OXXOPVIDIJYFQD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|