C15H21N5O5 — CID 175808743
[2-(2-amino-6-methoxy-8-oxo-7-propylpurin-9-yl)oxolan-3-yl] acetate (PubChem CID 175808743) has the molecular formula C15H21N5O5 and a molecular weight of 351.36 g/mol. Its IUPAC name is [2-(2-amino-6-methoxy-8-oxo-7-propylpurin-9-yl)oxolan-3-yl] acetate.
| Compound Name | [2-(2-amino-6-methoxy-8-oxo-7-propylpurin-9-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 175808743 |
| Molecular Formula | C15H21N5O5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [2-(2-amino-6-methoxy-8-oxo-7-propylpurin-9-yl)oxolan-3-yl] acetate |
| SMILES | CCCn1c(=O)n(C2OCCC2OC(C)=O)c2nc(N)nc(OC)c21 |
| InChI | InChI=1S/C15H21N5O5/c1-4-6-19-10-11(17-14(16)18-12(10)23-3)20(15(19)22)13-9(5-7-24-13)25-8(2)21/h9,13H,4-7H2,1-3H3,(H2,16,17,18) |
| InChIKey | QIZIGVUXGNROSX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |