C15H16FN5O5 — CID 175808904
[2-(2-amino-6-methoxy-8-oxo-7-prop-2-ynylpurin-9-yl)-4-fluorooxolan-3-yl] acetate (PubChem CID 175808904) has the molecular formula C15H16FN5O5 and a molecular weight of 365.32 g/mol. Its IUPAC name is [2-(2-amino-6-methoxy-8-oxo-7-prop-2-ynylpurin-9-yl)-4-fluorooxolan-3-yl] acetate.
| Compound Name | [2-(2-amino-6-methoxy-8-oxo-7-prop-2-ynylpurin-9-yl)-4-fluorooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 175808904 |
| Molecular Formula | C15H16FN5O5 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [2-(2-amino-6-methoxy-8-oxo-7-prop-2-ynylpurin-9-yl)-4-fluorooxolan-3-yl] acetate |
| SMILES | C#CCn1c(=O)n(C2OCC(F)C2OC(C)=O)c2nc(N)nc(OC)c21 |
| InChI | InChI=1S/C15H16FN5O5/c1-4-5-20-9-11(18-14(17)19-12(9)24-3)21(15(20)23)13-10(26-7(2)22)8(16)6-25-13/h1,8,10,13H,5-6H2,2-3H3,(H2,17,18,19) |
| InChIKey | WVBFTNVODZPICW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|