C20H25N5O6 — CID 161377046
[(2R,3R,5S)-2-(2-acetamido-6,8-dioxo-7-prop-2-ynyl-1H-purin-9-yl)-5-[(2R)-butan-2-yl]oxolan-3-yl] acetate (PubChem CID 161377046) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is [(2R,3R,5S)-2-(2-acetamido-6,8-dioxo-7-prop-2-ynyl-1H-purin-9-yl)-5-[(2R)-butan-2-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5S)-2-(2-acetamido-6,8-dioxo-7-prop-2-ynyl-1H-purin-9-yl)-5-[(2R)-butan-2-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 161377046 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [(2R,3R,5S)-2-(2-acetamido-6,8-dioxo-7-prop-2-ynyl-1H-purin-9-yl)-5-[(2R)-butan-2-yl]oxolan-3-yl] acetate |
| SMILES | C#CCn1c(=O)n([C@@H]2O[C@H]([C@H](C)CC)C[C@H]2OC(C)=O)c2nc(NC(C)=O)[nH]c(=O)c21 |
| InChI | InChI=1S/C20H25N5O6/c1-6-8-24-15-16(22-19(21-11(4)26)23-17(15)28)25(20(24)29)18-14(30-12(5)27)9-13(31-18)10(3)7-2/h1,10,13-14,18H,7-9H2,2-5H3,(H2,21,22,23,26,28)/t10-,13+,14-,18-/m1/s1 |
| InChIKey | OQLLHLPOLDAROJ-JUWZCLJNSA-N |
| XLogP | 0.74 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|