C14H15N5O4 — CID 175808764
[2-(2-amino-8-oxo-7-prop-2-ynylpurin-9-yl)oxolan-3-yl] acetate (PubChem CID 175808764) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is [2-(2-amino-8-oxo-7-prop-2-ynylpurin-9-yl)oxolan-3-yl] acetate.
| Compound Name | [2-(2-amino-8-oxo-7-prop-2-ynylpurin-9-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 175808764 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [2-(2-amino-8-oxo-7-prop-2-ynylpurin-9-yl)oxolan-3-yl] acetate |
| SMILES | C#CCn1c(=O)n(C2OCCC2OC(C)=O)c2nc(N)ncc21 |
| InChI | InChI=1S/C14H15N5O4/c1-3-5-18-9-7-16-13(15)17-11(9)19(14(18)21)12-10(4-6-22-12)23-8(2)20/h1,7,10,12H,4-6H2,2H3,(H2,15,16,17) |
| InChIKey | MDAOBEMBPPBMPT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|