C18H22N6O6 — CID 175102138
methyl 2-[(2S,4R,5R)-4-acetyloxy-5-[2-amino-7-(3-cyanopropyl)-8-oxopurin-9-yl]oxolan-2-yl]acetate (PubChem CID 175102138) has the molecular formula C18H22N6O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is methyl 2-[(2S,4R,5R)-4-acetyloxy-5-[2-amino-7-(3-cyanopropyl)-8-oxopurin-9-yl]oxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4R,5R)-4-acetyloxy-5-[2-amino-7-(3-cyanopropyl)-8-oxopurin-9-yl]oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 175102138 |
| Molecular Formula | C18H22N6O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 2-[(2S,4R,5R)-4-acetyloxy-5-[2-amino-7-(3-cyanopropyl)-8-oxopurin-9-yl]oxolan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H](OC(C)=O)[C@H](n2c(=O)n(CCCC#N)c3cnc(N)nc32)O1 |
| InChI | InChI=1S/C18H22N6O6/c1-10(25)29-13-7-11(8-14(26)28-2)30-16(13)24-15-12(9-21-17(20)22-15)23(18(24)27)6-4-3-5-19/h9,11,13,16H,3-4,6-8H2,1-2H3,(H2,20,21,22)/t11-,13+,16+/m0/s1 |
| InChIKey | FLVFGKJQSXYKLH-NORZTCDRSA-N |
| XLogP | 0.26 |
| TPSA | 164.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|