C17H17N5O9 — CID 137048396
[(2R,3R,3aS,6S,6aS)-2-(2-acetamido-6-oxo-1H-purin-7-yl)-6-acetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate (PubChem CID 137048396) has the molecular formula C17H17N5O9 and a molecular weight of 435.35 g/mol. Its IUPAC name is [(2R,3R,3aS,6S,6aS)-2-(2-acetamido-6-oxo-1H-purin-7-yl)-6-acetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate.
| Compound Name | [(2R,3R,3aS,6S,6aS)-2-(2-acetamido-6-oxo-1H-purin-7-yl)-6-acetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 137048396 |
| Molecular Formula | C17H17N5O9 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | [(2R,3R,3aS,6S,6aS)-2-(2-acetamido-6-oxo-1H-purin-7-yl)-6-acetyloxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
| SMILES | CC(=O)Nc1nc2ncn([C@@H]3O[C@H]4[C@H](OC(=O)[C@H]4OC(C)=O)[C@H]3OC(C)=O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H17N5O9/c1-5(23)19-17-20-13-8(14(26)21-17)22(4-18-13)15-11(28-6(2)24)9-10(30-15)12(16(27)31-9)29-7(3)25/h4,9-12,15H,1-3H3,(H2,19,20,21,23,26)/t9-,10-,11+,12-,15+/m0/s1 |
| InChIKey | FZFDHYPNZKTUHT-QKZHPOIUSA-N |
| XLogP | -1.24 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|