C15H14N4O9 — CID 124903519
[(2R,3S,3aR,6S,6aS)-6-acetyloxy-2-(2,6-dioxo-3H-purin-7-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate (PubChem CID 124903519) has the molecular formula C15H14N4O9 and a molecular weight of 394.30 g/mol. Its IUPAC name is [(2R,3S,3aR,6S,6aS)-6-acetyloxy-2-(2,6-dioxo-3H-purin-7-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate.
| Compound Name | [(2R,3S,3aR,6S,6aS)-6-acetyloxy-2-(2,6-dioxo-3H-purin-7-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 124903519 |
| Molecular Formula | C15H14N4O9 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [(2R,3S,3aR,6S,6aS)-6-acetyloxy-2-(2,6-dioxo-3H-purin-7-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(=O)[C@@H](OC(C)=O)[C@H]2O[C@H]1n1cnc2[nH]c(=O)[nH]c(=O)c21 |
| InChI | InChI=1S/C15H14N4O9/c1-4(20)25-9-7-8(10(14(23)28-7)26-5(2)21)27-13(9)19-3-16-11-6(19)12(22)18-15(24)17-11/h3,7-10,13H,1-2H3,(H2,17,18,22,24)/t7-,8+,9+,10+,13-/m1/s1 |
| InChIKey | ZECWZCNFRIDGKJ-STDGDXHASA-N |
| XLogP | -1.90 |
| TPSA | 171.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|