C11H14O8 — CID 139795590
[(3R,3aS,6S,6aS)-6-acetyloxy-2-(deuteriomethoxy)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate (PubChem CID 139795590) has the molecular formula C11H14O8 and a molecular weight of 275.23 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-acetyloxy-2-(deuteriomethoxy)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate.
| Compound Name | [(3R,3aS,6S,6aS)-6-acetyloxy-2-(deuteriomethoxy)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 139795590 |
| Molecular Formula | C11H14O8 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-acetyloxy-2-(deuteriomethoxy)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] acetate |
| SMILES | [2H]COC1O[C@H]2[C@H](OC(=O)[C@H]2OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H14O8/c1-4(12)16-8-6-7(18-10(8)14)9(17-5(2)13)11(15-3)19-6/h6-9,11H,1-3H3/t6-,7-,8-,9+,11?/m0/s1/i3D |
| InChIKey | VLGCEXZSQMHPDM-CXEYJHJJSA-N |
| XLogP | -0.85 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|