C9H12O6 — CID 100977147
[(3R,3aS,5R,6S,6aS)-5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate (PubChem CID 100977147) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is [(3R,3aS,5R,6S,6aS)-5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate.
| Compound Name | [(3R,3aS,5R,6S,6aS)-5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 100977147 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | [(3R,3aS,5R,6S,6aS)-5,6-dihydroxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)O[C@@H]2[C@@H](O)[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C9H12O6/c1-3(10)14-8-4-2-5(11)6(12)7(4)15-9(8)13/h4-8,11-12H,2H2,1H3/t4-,5+,6-,7-,8+/m0/s1 |
| InChIKey | JNSGEEDHOZMXMP-GWVFRZDISA-N |
| XLogP | -1.41 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |