C10H12O8 — CID 10967227
[(1S,2R,3R,4R,5S)-2-acetyloxy-4-hydroxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate (PubChem CID 10967227) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is [(1S,2R,3R,4R,5S)-2-acetyloxy-4-hydroxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate.
| Compound Name | [(1S,2R,3R,4R,5S)-2-acetyloxy-4-hydroxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
|---|---|
| PubChem CID | 10967227 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | [(1S,2R,3R,4R,5S)-2-acetyloxy-4-hydroxy-7-oxo-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@@H]2OC(=O)[C@@H](O2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H12O8/c1-3(11)15-6-5(13)10-17-8(9(14)18-10)7(6)16-4(2)12/h5-8,10,13H,1-2H3/t5-,6-,7-,8+,10+/m1/s1 |
| InChIKey | SYWHGBYZVZNLSY-BGJNVIQHSA-N |
| XLogP | -1.51 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|