C10H15BrO6 — CID 174063969
[(2S,5S)-3-acetyloxy-2-bromo-5-hydroxy-6-methyloxan-4-yl] acetate (PubChem CID 174063969) has the molecular formula C10H15BrO6 and a molecular weight of 311.13 g/mol. Its IUPAC name is [(2S,5S)-3-acetyloxy-2-bromo-5-hydroxy-6-methyloxan-4-yl] acetate.
| Compound Name | [(2S,5S)-3-acetyloxy-2-bromo-5-hydroxy-6-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 174063969 |
| Molecular Formula | C10H15BrO6 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | [(2S,5S)-3-acetyloxy-2-bromo-5-hydroxy-6-methyloxan-4-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@H](Br)OC(C)[C@@H]1O |
| InChI | InChI=1S/C10H15BrO6/c1-4-7(14)8(16-5(2)12)9(10(11)15-4)17-6(3)13/h4,7-10,14H,1-3H3/t4?,7-,8?,9?,10+/m0/s1 |
| InChIKey | RFJKEQVJPCUMCJ-CVENXGGASA-N |
| XLogP | 0.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|