C14H13N5O2 — CID 135471186
N-(7-benzyl-6-oxo-1H-purin-2-yl)acetamide (PubChem CID 135471186) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is N-(7-benzyl-6-oxo-1H-purin-2-yl)acetamide.
| Compound Name | N-(7-benzyl-6-oxo-1H-purin-2-yl)acetamide |
|---|---|
| PubChem CID | 135471186 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-(7-benzyl-6-oxo-1H-purin-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc2ncn(Cc3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H13N5O2/c1-9(20)16-14-17-12-11(13(21)18-14)19(8-15-12)7-10-5-3-2-4-6-10/h2-6,8H,7H2,1H3,(H2,16,17,18,20,21) |
| InChIKey | XAGPLKSHMHHBIP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |