C16H12N6O3 — CID 156762446
1-(7-benzyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylic acid (PubChem CID 156762446) has the molecular formula C16H12N6O3 and a molecular weight of 336.31 g/mol. Its IUPAC name is 1-(7-benzyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(7-benzyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 156762446 |
| Molecular Formula | C16H12N6O3 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-(7-benzyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2nc3ncn(Cc4ccccc4)c3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C16H12N6O3/c23-14-12-13(17-9-21(12)7-10-4-2-1-3-5-10)19-16(20-14)22-8-11(6-18-22)15(24)25/h1-6,8-9H,7H2,(H,24,25)(H,19,20,23) |
| InChIKey | XPGIMIFYGAFDNC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |