C17H14N6O3S — CID 156762463
1-[9-[(4-methylsulfanylphenyl)methyl]-6-oxo-1H-purin-2-yl]pyrazole-4-carboxylic acid (PubChem CID 156762463) has the molecular formula C17H14N6O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-[9-[(4-methylsulfanylphenyl)methyl]-6-oxo-1H-purin-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[9-[(4-methylsulfanylphenyl)methyl]-6-oxo-1H-purin-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 156762463 |
| Molecular Formula | C17H14N6O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1-[9-[(4-methylsulfanylphenyl)methyl]-6-oxo-1H-purin-2-yl]pyrazole-4-carboxylic acid |
| SMILES | CSc1ccc(Cn2cnc3c(=O)[nH]c(-n4cc(C(=O)O)cn4)nc32)cc1 |
| InChI | InChI=1S/C17H14N6O3S/c1-27-12-4-2-10(3-5-12)7-22-9-18-13-14(22)20-17(21-15(13)24)23-8-11(6-19-23)16(25)26/h2-6,8-9H,7H2,1H3,(H,25,26)(H,20,21,24) |
| InChIKey | VDVUIGXVNDVMFE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |