C12H12N6O3 — CID 156762319
ethyl 1-(9-methyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylate (PubChem CID 156762319) has the molecular formula C12H12N6O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is ethyl 1-(9-methyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(9-methyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 156762319 |
| Molecular Formula | C12H12N6O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | ethyl 1-(9-methyl-6-oxo-1H-purin-2-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc3c(ncn3C)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C12H12N6O3/c1-3-21-11(20)7-4-14-18(5-7)12-15-9-8(10(19)16-12)13-6-17(9)2/h4-6H,3H2,1-2H3,(H,15,16,19) |
| InChIKey | GMDPZFJXOOPCSM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |